C22H34N2O4 — CID 118488060
tert-butyl 3-methyl-2-[2-(phenylmethoxycarbonylamino)ethyl]azepane-1-carboxylate (PubChem CID 118488060) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl 3-methyl-2-[2-(phenylmethoxycarbonylamino)ethyl]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-2-[2-(phenylmethoxycarbonylamino)ethyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 118488060 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | tert-butyl 3-methyl-2-[2-(phenylmethoxycarbonylamino)ethyl]azepane-1-carboxylate |
| SMILES | CC1CCCCN(C(=O)OC(C)(C)C)C1CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H34N2O4/c1-17-10-8-9-15-24(21(26)28-22(2,3)4)19(17)13-14-23-20(25)27-16-18-11-6-5-7-12-18/h5-7,11-12,17,19H,8-10,13-16H2,1-4H3,(H,23,25) |
| InChIKey | XCSUIXUBKHYMIB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |