C16H24O — CID 91749847
8,8-dimethyl-4,6-bis(prop-1-en-2-yl)bicyclo[5.1.0]octan-2-one (PubChem CID 91749847) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 8,8-dimethyl-4,6-bis(prop-1-en-2-yl)bicyclo[5.1.0]octan-2-one.
| Compound Name | 8,8-dimethyl-4,6-bis(prop-1-en-2-yl)bicyclo[5.1.0]octan-2-one |
|---|---|
| PubChem CID | 91749847 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 8,8-dimethyl-4,6-bis(prop-1-en-2-yl)bicyclo[5.1.0]octan-2-one |
| SMILES | C=C(C)C1CC(=O)C2C(C(C(=C)C)C1)C2(C)C |
| InChI | InChI=1S/C16H24O/c1-9(2)11-7-12(10(3)4)14-15(13(17)8-11)16(14,5)6/h11-12,14-15H,1,3,7-8H2,2,4-6H3 |
| InChIKey | DVEMIUDQMPVUPV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|