C15H22O — CID 102400968
(4aR,5S,7R,8aR)-4a,5-dimethyl-7-prop-1-en-2-yl-1,5,6,7,8,8a-hexahydronaphthalen-2-one (PubChem CID 102400968) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (4aR,5S,7R,8aR)-4a,5-dimethyl-7-prop-1-en-2-yl-1,5,6,7,8,8a-hexahydronaphthalen-2-one.
| Compound Name | (4aR,5S,7R,8aR)-4a,5-dimethyl-7-prop-1-en-2-yl-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 102400968 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (4aR,5S,7R,8aR)-4a,5-dimethyl-7-prop-1-en-2-yl-1,5,6,7,8,8a-hexahydronaphthalen-2-one |
| SMILES | C=C(C)[C@H]1C[C@@H]2CC(=O)C=C[C@]2(C)[C@@H](C)C1 |
| InChI | InChI=1S/C15H22O/c1-10(2)12-7-11(3)15(4)6-5-14(16)9-13(15)8-12/h5-6,11-13H,1,7-9H2,2-4H3/t11-,12+,13+,15+/m0/s1 |
| InChIKey | WYHSEUMHLNOXEB-KYEXWDHISA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|