C18H26O4 — CID 122180237
(1S,4R,9S,10R,13R,14S)-13,14-dihydroxy-14-(hydroxymethyl)-9-methyltetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one (PubChem CID 122180237) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (1S,4R,9S,10R,13R,14S)-13,14-dihydroxy-14-(hydroxymethyl)-9-methyltetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one.
| Compound Name | (1S,4R,9S,10R,13R,14S)-13,14-dihydroxy-14-(hydroxymethyl)-9-methyltetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one |
|---|---|
| PubChem CID | 122180237 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (1S,4R,9S,10R,13R,14S)-13,14-dihydroxy-14-(hydroxymethyl)-9-methyltetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one |
| SMILES | C[C@@]12C=CC(=O)C[C@H]1CC[C@]13C[C@](O)(CO)[C@@](O)(CC[C@H]12)C3 |
| InChI | InChI=1S/C18H26O4/c1-15-5-3-13(20)8-12(15)2-6-16-9-17(21,7-4-14(15)16)18(22,10-16)11-19/h3,5,12,14,19,21-22H,2,4,6-11H2,1H3/t12-,14+,15-,16+,17-,18+/m1/s1 |
| InChIKey | XWOCMLGYYIIDPY-WLZXLALPSA-N |
| XLogP | 1.58 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |