C8H9NO2 — CID 82417389
4,5,6,7-tetrahydrofuro[2,3-d]azepin-8-one (PubChem CID 82417389) has the molecular formula C8H9NO2 and a molecular weight of 151.17 g/mol. Its IUPAC name is 4,5,6,7-tetrahydrofuro[2,3-d]azepin-8-one.
| Compound Name | 4,5,6,7-tetrahydrofuro[2,3-d]azepin-8-one |
|---|---|
| PubChem CID | 82417389 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 4,5,6,7-tetrahydrofuro[2,3-d]azepin-8-one |
| SMILES | O=C1CNCCc2ccoc21 |
| InChI | InChI=1S/C8H9NO2/c10-7-5-9-3-1-6-2-4-11-8(6)7/h2,4,9H,1,3,5H2 |
| InChIKey | TYCKSVTUMIEXGW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |