C13H16O2 — CID 135039054
(6aS)-6a-methyl-4,5,6,7,8,9a-hexahydroazuleno[8,7-b]furan-9-one (PubChem CID 135039054) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (6aS)-6a-methyl-4,5,6,7,8,9a-hexahydroazuleno[8,7-b]furan-9-one.
| Compound Name | (6aS)-6a-methyl-4,5,6,7,8,9a-hexahydroazuleno[8,7-b]furan-9-one |
|---|---|
| PubChem CID | 135039054 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (6aS)-6a-methyl-4,5,6,7,8,9a-hexahydroazuleno[8,7-b]furan-9-one |
| SMILES | C[C@@]12CCCc3ccoc3C1C(=O)CC2 |
| InChI | InChI=1S/C13H16O2/c1-13-6-2-3-9-5-8-15-12(9)11(13)10(14)4-7-13/h5,8,11H,2-4,6-7H2,1H3/t11?,13-/m0/s1 |
| InChIKey | GQXPPDAZEIXQCC-YUZLPWPTSA-N |
| XLogP | 3.07 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |