C15H20O2 — CID 102209636
(5aR,6R,9aS)-6-propan-2-yl-5,5a,6,7,8,9a-hexahydro-4H-benzo[g][1]benzofuran-9-one (PubChem CID 102209636) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (5aR,6R,9aS)-6-propan-2-yl-5,5a,6,7,8,9a-hexahydro-4H-benzo[g][1]benzofuran-9-one.
| Compound Name | (5aR,6R,9aS)-6-propan-2-yl-5,5a,6,7,8,9a-hexahydro-4H-benzo[g][1]benzofuran-9-one |
|---|---|
| PubChem CID | 102209636 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (5aR,6R,9aS)-6-propan-2-yl-5,5a,6,7,8,9a-hexahydro-4H-benzo[g][1]benzofuran-9-one |
| SMILES | CC(C)[C@H]1CCC(=O)[C@@H]2c3occc3CC[C@@H]21 |
| InChI | InChI=1S/C15H20O2/c1-9(2)11-5-6-13(16)14-12(11)4-3-10-7-8-17-15(10)14/h7-9,11-12,14H,3-6H2,1-2H3/t11-,12-,14-/m1/s1 |
| InChIKey | VLBWBXKLKLWUHB-YRGRVCCFSA-N |
| XLogP | 3.56 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |