C10H13NO — CID 112714220
5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole (PubChem CID 112714220) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole.
| Compound Name | 5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole |
|---|---|
| PubChem CID | 112714220 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole |
| SMILES | c1cc2c(o1)C1NCCC1CC2 |
| InChI | InChI=1S/C10H13NO/c1-2-8-4-6-12-10(8)9-7(1)3-5-11-9/h4,6-7,9,11H,1-3,5H2 |
| InChIKey | RZEZMUGOHHBMQP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |