C13H19NO — CID 112715804
2-propan-2-yl-5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole (PubChem CID 112715804) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-propan-2-yl-5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole.
| Compound Name | 2-propan-2-yl-5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole |
|---|---|
| PubChem CID | 112715804 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-propan-2-yl-5,5a,6,7,8,8a-hexahydro-4H-furo[3,2-g]indole |
| SMILES | CC(C)c1cc2c(o1)C1NCCC1CC2 |
| InChI | InChI=1S/C13H19NO/c1-8(2)11-7-10-4-3-9-5-6-14-12(9)13(10)15-11/h7-9,12,14H,3-6H2,1-2H3 |
| InChIKey | BHPKUSTZKVXMBL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |