C11H12ClN — CID 83878665
6-chloro-1,2,3,3a,4,8b-hexahydroindeno[1,2-b]pyrrole (PubChem CID 83878665) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 6-chloro-1,2,3,3a,4,8b-hexahydroindeno[1,2-b]pyrrole.
| Compound Name | 6-chloro-1,2,3,3a,4,8b-hexahydroindeno[1,2-b]pyrrole |
|---|---|
| PubChem CID | 83878665 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 6-chloro-1,2,3,3a,4,8b-hexahydroindeno[1,2-b]pyrrole |
| SMILES | Clc1ccc2c(c1)CC1CCNC21 |
| InChI | InChI=1S/C11H12ClN/c12-9-1-2-10-8(6-9)5-7-3-4-13-11(7)10/h1-2,6-7,11,13H,3-5H2 |
| InChIKey | OQFQVMJSKPLQSI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |