C12H14ClNO — CID 118712369
7-chloro-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol (PubChem CID 118712369) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 7-chloro-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol.
| Compound Name | 7-chloro-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol |
|---|---|
| PubChem CID | 118712369 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 7-chloro-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridin-8-ol |
| SMILES | Oc1cc2c(cc1Cl)CC1CCCNC21 |
| InChI | InChI=1S/C12H14ClNO/c13-10-5-8-4-7-2-1-3-14-12(7)9(8)6-11(10)15/h5-7,12,14-15H,1-4H2 |
| InChIKey | XHDNAIUOGWZVTP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |