C12H14ClNS — CID 83912553
8-chloro-2,3,4,4a,5,10b-hexahydro-1H-thiochromeno[4,3-b]pyridine (PubChem CID 83912553) has the molecular formula C12H14ClNS and a molecular weight of 239.77 g/mol. Its IUPAC name is 8-chloro-2,3,4,4a,5,10b-hexahydro-1H-thiochromeno[4,3-b]pyridine.
| Compound Name | 8-chloro-2,3,4,4a,5,10b-hexahydro-1H-thiochromeno[4,3-b]pyridine |
|---|---|
| PubChem CID | 83912553 |
| Molecular Formula | C12H14ClNS |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 8-chloro-2,3,4,4a,5,10b-hexahydro-1H-thiochromeno[4,3-b]pyridine |
| SMILES | Clc1ccc2c(c1)SCC1CCCNC21 |
| InChI | InChI=1S/C12H14ClNS/c13-9-3-4-10-11(6-9)15-7-8-2-1-5-14-12(8)10/h3-4,6,8,12,14H,1-2,5,7H2 |
| InChIKey | WMLQVNVYYDZYSF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |