C11H15ClN2 — CID 22880723
(2R,3R)-2-(3-chlorophenyl)piperidin-3-amine (PubChem CID 22880723) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is (2R,3R)-2-(3-chlorophenyl)piperidin-3-amine.
| Compound Name | (2R,3R)-2-(3-chlorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 22880723 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2R,3R)-2-(3-chlorophenyl)piperidin-3-amine |
| SMILES | N[C@@H]1CCCN[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2/c12-9-4-1-3-8(7-9)11-10(13)5-2-6-14-11/h1,3-4,7,10-11,14H,2,5-6,13H2/t10-,11-/m1/s1 |
| InChIKey | CIFBTUDQBBZGFL-GHMZBOCLSA-N |
| XLogP | 2.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |