C14H18ClN — CID 105497348
2-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidine (PubChem CID 105497348) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is 2-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidine.
| Compound Name | 2-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 105497348 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidine |
| SMILES | Clc1ccc2c(c1)CCC(C1CCCN1)C2 |
| InChI | InChI=1S/C14H18ClN/c15-13-6-5-10-8-12(4-3-11(10)9-13)14-2-1-7-16-14/h5-6,9,12,14,16H,1-4,7-8H2 |
| InChIKey | OLCPWUQHORTRLE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |