C10H10ClN3 — CID 90898481
2-azido-6-chloro-1,2,3,4-tetrahydronaphthalene (PubChem CID 90898481) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 2-azido-6-chloro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-azido-6-chloro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 90898481 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-azido-6-chloro-1,2,3,4-tetrahydronaphthalene |
| SMILES | [N-]=[N+]=NC1CCc2cc(Cl)ccc2C1 |
| InChI | InChI=1S/C10H10ClN3/c11-9-3-1-8-6-10(13-14-12)4-2-7(8)5-9/h1,3,5,10H,2,4,6H2 |
| InChIKey | JYQCIWZAGXXQGJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|