C9H8ClF — CID 84717388
6-chloro-1-fluoro-2,3-dihydro-1H-indene (PubChem CID 84717388) has the molecular formula C9H8ClF and a molecular weight of 170.61 g/mol. Its IUPAC name is 6-chloro-1-fluoro-2,3-dihydro-1H-indene.
| Compound Name | 6-chloro-1-fluoro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 84717388 |
| Molecular Formula | C9H8ClF |
| Molecular Weight | 170.61 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 6-chloro-1-fluoro-2,3-dihydro-1H-indene |
| SMILES | FC1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H8ClF/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5,9H,2,4H2 |
| InChIKey | NIZJSNBUDUBEPG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |