C9H11ClN2 — CID 124537604
[(1R)-6-chloro-2,3-dihydro-1H-inden-1-yl]hydrazine (PubChem CID 124537604) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is [(1R)-6-chloro-2,3-dihydro-1H-inden-1-yl]hydrazine.
| Compound Name | [(1R)-6-chloro-2,3-dihydro-1H-inden-1-yl]hydrazine |
|---|---|
| PubChem CID | 124537604 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | [(1R)-6-chloro-2,3-dihydro-1H-inden-1-yl]hydrazine |
| SMILES | NN[C@@H]1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H11ClN2/c10-7-3-1-6-2-4-9(12-11)8(6)5-7/h1,3,5,9,12H,2,4,11H2/t9-/m1/s1 |
| InChIKey | BDJWKLUKVQVUBO-SECBINFHSA-N |
| XLogP | 1.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|