C12H16ClN — CID 61383375
6-chloro-N-propyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 61383375) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 6-chloro-N-propyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 6-chloro-N-propyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 61383375 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 6-chloro-N-propyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCNC1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H16ClN/c1-2-7-14-12-6-4-9-3-5-10(13)8-11(9)12/h3,5,8,12,14H,2,4,6-7H2,1H3 |
| InChIKey | DBIQMRIWMIZJPP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |