C10H12FN — CID 83853754
(3-fluoro-2,3-dihydro-1H-inden-5-yl)methanamine (PubChem CID 83853754) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is (3-fluoro-2,3-dihydro-1H-inden-5-yl)methanamine.
| Compound Name | (3-fluoro-2,3-dihydro-1H-inden-5-yl)methanamine |
|---|---|
| PubChem CID | 83853754 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (3-fluoro-2,3-dihydro-1H-inden-5-yl)methanamine |
| SMILES | NCc1ccc2c(c1)C(F)CC2 |
| InChI | InChI=1S/C10H12FN/c11-10-4-3-8-2-1-7(6-12)5-9(8)10/h1-2,5,10H,3-4,6,12H2 |
| InChIKey | QEHDKQNWDMSSSD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |