About 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine
7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine (PubChem CID 84720668) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine.
Analyze 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine?
The IUPAC name of 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine (CID 84720668) is 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine.
What is the SMILES notation for 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine?
The canonical SMILES for 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine is CC1CCc2cc(Cl)ccc2CN1.
What is the InChIKey of 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine?
The InChIKey is ZHFBSGDHOHYTPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN/c1-8-2-3-9-6-11(12)5-4-10(9)7-13-8/h4-6,8,13H,2-3,7H2,1H3.
What are the key properties of 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine?
7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine has a molecular weight of 195.69 g/mol, XLogP of 2.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-methyl-2,3,4,5-tetrahydro-1H-2-benzazepine is sourced from PubChem (CID 84720668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).