C15H20O — CID 23427471
(9R,10S)-9,10-dimethyl-11-methylidene-3-oxatricyclo[7.3.1.02,6]trideca-2(6),4-diene (PubChem CID 23427471) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (9R,10S)-9,10-dimethyl-11-methylidene-3-oxatricyclo[7.3.1.02,6]trideca-2(6),4-diene.
| Compound Name | (9R,10S)-9,10-dimethyl-11-methylidene-3-oxatricyclo[7.3.1.02,6]trideca-2(6),4-diene |
|---|---|
| PubChem CID | 23427471 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (9R,10S)-9,10-dimethyl-11-methylidene-3-oxatricyclo[7.3.1.02,6]trideca-2(6),4-diene |
| SMILES | C=C1CC2C[C@@](C)(CCc3ccoc32)[C@H]1C |
| InChI | InChI=1S/C15H20O/c1-10-8-13-9-15(3,11(10)2)6-4-12-5-7-16-14(12)13/h5,7,11,13H,1,4,6,8-9H2,2-3H3/t11-,13?,15+/m0/s1 |
| InChIKey | USLKVNXKOILJKL-LKVSRFHLSA-N |
| XLogP | 4.30 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|