C36H40O8 — CID 11490337
3,3,8,8,15,15,20,20-octamethyltricyclo[20.2.2.210,13]octacosa-1(25),10,12,22(26),23,27-hexaene-4,5,6,7,16,17,18,19-octone (PubChem CID 11490337) has the molecular formula C36H40O8 and a molecular weight of 600.71 g/mol. Its IUPAC name is 3,3,8,8,15,15,20,20-octamethyltricyclo[20.2.2.210,13]octacosa-1(25),10,12,22(26),23,27-hexaene-4,5,6,7,16,17,18,19-octone.
| Compound Name | 3,3,8,8,15,15,20,20-octamethyltricyclo[20.2.2.210,13]octacosa-1(25),10,12,22(26),23,27-hexaene-4,5,6,7,16,17,18,19-octone |
|---|---|
| PubChem CID | 11490337 |
| Molecular Formula | C36H40O8 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 3,3,8,8,15,15,20,20-octamethyltricyclo[20.2.2.210,13]octacosa-1(25),10,12,22(26),23,27-hexaene-4,5,6,7,16,17,18,19-octone |
| SMILES | CC1(C)Cc2ccc(cc2)CC(C)(C)C(=O)C(=O)C(=O)C(=O)C(C)(C)Cc2ccc(cc2)CC(C)(C)C(=O)C(=O)C(=O)C1=O |
| InChI | InChI=1S/C36H40O8/c1-33(2)17-21-9-11-22(12-10-21)18-35(5,6)31(43)27(39)28(40)32(44)36(7,8)20-24-15-13-23(14-16-24)19-34(3,4)30(42)26(38)25(37)29(33)41/h9-16H,17-20H2,1-8H3 |
| InChIKey | JGCZUDFJMZXQRK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|