C15H12FNO3 — CID 171919161
3-(4-fluorophenyl)-6,6-dimethyl-7H-2,1-benzoxazole-4,5-dione (PubChem CID 171919161) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6,6-dimethyl-7H-2,1-benzoxazole-4,5-dione.
| Compound Name | 3-(4-fluorophenyl)-6,6-dimethyl-7H-2,1-benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 171919161 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-(4-fluorophenyl)-6,6-dimethyl-7H-2,1-benzoxazole-4,5-dione |
| SMILES | CC1(C)Cc2noc(-c3ccc(F)cc3)c2C(=O)C1=O |
| InChI | InChI=1S/C15H12FNO3/c1-15(2)7-10-11(12(18)14(15)19)13(20-17-10)8-3-5-9(16)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | GKNUWKYSBFGTIU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|