C20H21NO — CID 44631650
5-(dimethylamino)-5-methyl-2,3-diphenylcyclopent-2-en-1-one (PubChem CID 44631650) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 5-(dimethylamino)-5-methyl-2,3-diphenylcyclopent-2-en-1-one.
| Compound Name | 5-(dimethylamino)-5-methyl-2,3-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 44631650 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-(dimethylamino)-5-methyl-2,3-diphenylcyclopent-2-en-1-one |
| SMILES | CN(C)C1(C)CC(c2ccccc2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H21NO/c1-20(21(2)3)14-17(15-10-6-4-7-11-15)18(19(20)22)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3 |
| InChIKey | LONOQARWTUVJLY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|