C30H31NO4S — CID 102219443
2-benzylsulfonyl-4-(2-hydroxypropan-2-yl)-7,8-diphenyl-2-azaspiro[4.4]non-7-en-9-one (PubChem CID 102219443) has the molecular formula C30H31NO4S and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-benzylsulfonyl-4-(2-hydroxypropan-2-yl)-7,8-diphenyl-2-azaspiro[4.4]non-7-en-9-one.
| Compound Name | 2-benzylsulfonyl-4-(2-hydroxypropan-2-yl)-7,8-diphenyl-2-azaspiro[4.4]non-7-en-9-one |
|---|---|
| PubChem CID | 102219443 |
| Molecular Formula | C30H31NO4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 2-benzylsulfonyl-4-(2-hydroxypropan-2-yl)-7,8-diphenyl-2-azaspiro[4.4]non-7-en-9-one |
| SMILES | CC(C)(O)C1CN(S(=O)(=O)Cc2ccccc2)CC12CC(c1ccccc1)=C(c1ccccc1)C2=O |
| InChI | InChI=1S/C30H31NO4S/c1-29(2,33)26-19-31(36(34,35)20-22-12-6-3-7-13-22)21-30(26)18-25(23-14-8-4-9-15-23)27(28(30)32)24-16-10-5-11-17-24/h3-17,26,33H,18-21H2,1-2H3 |
| InChIKey | FGCRKHWTWOKNIJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|