About 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one
2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 147193848) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
Analyze 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (CID 147193848) is 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is CC1(N)C2CC3C(=O)OC1C3O2.
What is the InChIKey of 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is KLSFXKYXZITQCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-8(9)4-2-3-5(11-4)6(8)12-7(3)10/h3-6H,2,9H2,1H3.
What are the key properties of 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 169.18 g/mol, XLogP of -0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 147193848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).