About 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one
2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 162700542) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
Analyze 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (CID 162700542) is 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is CC1(C)C2CC3C(=O)OC1(C)C3O2.
What is the InChIKey of 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is NBVXJBLBNLFMTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-9(2)6-4-5-7(12-6)10(9,3)13-8(5)11/h5-7H,4H2,1-3H3.
What are the key properties of 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 182.22 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-trimethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 162700542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).