C21H28O6 — CID 11440285
(1S,3R,10S,13S,15S,16S,20R)-15-hydroxy-3,10,16,18,18-pentamethyl-2,11,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-trien-12-one (PubChem CID 11440285) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (1S,3R,10S,13S,15S,16S,20R)-15-hydroxy-3,10,16,18,18-pentamethyl-2,11,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-trien-12-one.
| Compound Name | (1S,3R,10S,13S,15S,16S,20R)-15-hydroxy-3,10,16,18,18-pentamethyl-2,11,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-trien-12-one |
|---|---|
| PubChem CID | 11440285 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1S,3R,10S,13S,15S,16S,20R)-15-hydroxy-3,10,16,18,18-pentamethyl-2,11,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-trien-12-one |
| SMILES | C[C@@H]1OC(=O)[C@H]2C[C@H](O)[C@]3(C)OC(C)(C)O[C@@H]3[C@H]2O[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C21H28O6/c1-11-13-8-6-7-9-14(13)12(2)25-19(23)15-10-16(22)21(5)18(17(15)24-11)26-20(3,4)27-21/h6-9,11-12,15-18,22H,10H2,1-5H3/t11-,12+,15+,16+,17+,18-,21+/m1/s1 |
| InChIKey | UPLXOSKGWIGQSP-GBJURJOQSA-N |
| XLogP | 3.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |