C9H14O3 — CID 90685782
4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one;ethane (PubChem CID 90685782) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one;ethane.
| Compound Name | 4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one;ethane |
|---|---|
| PubChem CID | 90685782 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one;ethane |
| SMILES | CC.O=C1OC2CC3CC1C2O3 |
| InChI | InChI=1S/C7H8O3.C2H6/c8-7-4-1-3-2-5(10-7)6(4)9-3;1-2/h3-6H,1-2H2;1-2H3 |
| InChIKey | SEDHSMGUYBYBIO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |