C6H6O3 — CID 126970387
(1R,5S)-6-oxabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 126970387) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is (1R,5S)-6-oxabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,5S)-6-oxabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 126970387 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | (1R,5S)-6-oxabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | O=C1C[C@@H]2OC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C6H6O3/c7-3-1-4-5(2-3)9-6(4)8/h4-5H,1-2H2/t4-,5+/m1/s1 |
| InChIKey | ATNLPEJPDWAHDG-UHNVWZDZSA-N |
| XLogP | -0.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|