C7H8O2 — CID 141109024
bicyclo[3.2.0]heptane-3,6-dione (PubChem CID 141109024) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is bicyclo[3.2.0]heptane-3,6-dione.
| Compound Name | bicyclo[3.2.0]heptane-3,6-dione |
|---|---|
| PubChem CID | 141109024 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | bicyclo[3.2.0]heptane-3,6-dione |
| SMILES | O=C1CC2CC(=O)C2C1 |
| InChI | InChI=1S/C7H8O2/c8-5-1-4-2-7(9)6(4)3-5/h4,6H,1-3H2 |
| InChIKey | QCRBVSULBFNXKB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |