C7H9NO2 — CID 149429847
(1S,2R,5R)-2-amino-6-oxabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 149429847) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (1S,2R,5R)-2-amino-6-oxabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | (1S,2R,5R)-2-amino-6-oxabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 149429847 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (1S,2R,5R)-2-amino-6-oxabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | N[C@@H]1C=C[C@H]2C[C@@H]1C(=O)O2 |
| InChI | InChI=1S/C7H9NO2/c8-6-2-1-4-3-5(6)7(9)10-4/h1-2,4-6H,3,8H2/t4-,5-,6+/m0/s1 |
| InChIKey | YUVDQTVXYDCMAM-HCWXCVPCSA-N |
| XLogP | -0.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|