C10H13NO3 — CID 138980135
prop-2-enyl (1S,2S,3S,4R)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 138980135) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is prop-2-enyl (1S,2S,3S,4R)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | prop-2-enyl (1S,2S,3S,4R)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 138980135 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | prop-2-enyl (1S,2S,3S,4R)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H](N)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C10H13NO3/c1-2-5-13-10(12)8-6-3-4-7(14-6)9(8)11/h2-4,6-9H,1,5,11H2/t6-,7+,8+,9+/m0/s1 |
| InChIKey | WUSHHELLYJIBFU-JQCXWYLXSA-N |
| XLogP | -0.00 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|