About (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione
(5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 59110742) has the molecular formula C5H5NO3
and a molecular weight of 127.10 g/mol. Its IUPAC name is (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
Molecular Properties
| Compound Name | (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| PubChem CID | 59110742 |
| Molecular Formula | C5H5NO3 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | O=C1C[C@@H]2OC(=O)C2N1 |
| InChI | InChI=1S/C5H5NO3/c7-3-1-2-4(6-3)5(8)9-2/h2,4H,1H2,(H,6,7)/t2-,4?/m0/s1 |
| InChIKey | RBLXHLSQRPDVQD-PTLFGRINSA-N |
| XLogP | -1.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
The IUPAC name of (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (CID 59110742) is (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
What is the SMILES notation for (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
The canonical SMILES for (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione is O=C1C[C@@H]2OC(=O)C2N1.
What is the InChIKey of (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
The InChIKey is RBLXHLSQRPDVQD-PTLFGRINSA-N. The full InChI is InChI=1S/C5H5NO3/c7-3-1-2-4(6-3)5(8)9-2/h2,4H,1H2,(H,6,7)/t2-,4?/m0/s1.
What are the key properties of (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
(5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione has a molecular weight of 127.10 g/mol, XLogP of -1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione is sourced from PubChem (CID 59110742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).