About (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate
(2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate (PubChem CID 58734387) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate.
Analyze (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate?
The IUPAC name of (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate (CID 58734387) is (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate.
What is the SMILES notation for (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate?
The canonical SMILES for (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate is CC(=O)OC1(C)C2CC3C(=O)OC1C3O2.
What is the InChIKey of (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate?
The InChIKey is LANGGBMPLPTCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c1-4(11)15-10(2)6-3-5-7(13-6)8(10)14-9(5)12/h5-8H,3H2,1-2H3.
What are the key properties of (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate?
(2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate has a molecular weight of 212.20 g/mol, XLogP of 0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) acetate is sourced from PubChem (CID 58734387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).