About (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one
(1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 129082399) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
Molecular Properties
| Compound Name | (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| PubChem CID | 129082399 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | CC1(C)C2OC(=O)C3C[C@H]1CC32 |
| InChI | InChI=1S/C10H14O2/c1-10(2)5-3-6-7(4-5)9(11)12-8(6)10/h5-8H,3-4H2,1-2H3/t5-,6?,7?,8?/m1/s1 |
| InChIKey | NAOZOALSOHCLKU-NIYQRSRNSA-N |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (CID 129082399) is (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one is CC1(C)C2OC(=O)C3C[C@H]1CC32.
What is the InChIKey of (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is NAOZOALSOHCLKU-NIYQRSRNSA-N. The full InChI is InChI=1S/C10H14O2/c1-10(2)5-3-6-7(4-5)9(11)12-8(6)10/h5-8H,3-4H2,1-2H3/t5-,6?,7?,8?/m1/s1.
What are the key properties of (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
(1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 166.22 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2-dimethyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 129082399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).