C9H10O3 — CID 130028254
4-oxatricyclo[4.3.1.03,7]decane-2,5-dione (PubChem CID 130028254) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-oxatricyclo[4.3.1.03,7]decane-2,5-dione.
| Compound Name | 4-oxatricyclo[4.3.1.03,7]decane-2,5-dione |
|---|---|
| PubChem CID | 130028254 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-oxatricyclo[4.3.1.03,7]decane-2,5-dione |
| SMILES | O=C1OC2C(=O)C3CCC2C1C3 |
| InChI | InChI=1S/C9H10O3/c10-7-4-1-2-5-6(3-4)9(11)12-8(5)7/h4-6,8H,1-3H2 |
| InChIKey | SWIPPHDWGMZLPH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |