C20H20O2 — CID 101083176
(2R,3S)-3-ethenyl-2-phenyl-3-phenylmethoxy-2,6-dihydropyran (PubChem CID 101083176) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2R,3S)-3-ethenyl-2-phenyl-3-phenylmethoxy-2,6-dihydropyran.
| Compound Name | (2R,3S)-3-ethenyl-2-phenyl-3-phenylmethoxy-2,6-dihydropyran |
|---|---|
| PubChem CID | 101083176 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2R,3S)-3-ethenyl-2-phenyl-3-phenylmethoxy-2,6-dihydropyran |
| SMILES | C=C[C@]1(OCc2ccccc2)C=CCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20O2/c1-2-20(22-16-17-10-5-3-6-11-17)14-9-15-21-19(20)18-12-7-4-8-13-18/h2-14,19H,1,15-16H2/t19-,20+/m1/s1 |
| InChIKey | HFNVUXFAWPGISU-UXHICEINSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|