C21H26O4 — CID 11824069
(2R,3R,4R,4aS,9aS)-2-ethenyl-4-phenylmethoxy-3-prop-2-enoxy-3,4,4a,6,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine (PubChem CID 11824069) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R,3R,4R,4aS,9aS)-2-ethenyl-4-phenylmethoxy-3-prop-2-enoxy-3,4,4a,6,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine.
| Compound Name | (2R,3R,4R,4aS,9aS)-2-ethenyl-4-phenylmethoxy-3-prop-2-enoxy-3,4,4a,6,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine |
|---|---|
| PubChem CID | 11824069 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R,3R,4R,4aS,9aS)-2-ethenyl-4-phenylmethoxy-3-prop-2-enoxy-3,4,4a,6,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine |
| SMILES | C=CCO[C@H]1[C@H](OCc2ccccc2)[C@H]2OCC=CC[C@@H]2O[C@@H]1C=C |
| InChI | InChI=1S/C21H26O4/c1-3-13-22-19-17(4-2)25-18-12-8-9-14-23-20(18)21(19)24-15-16-10-6-5-7-11-16/h3-11,17-21H,1-2,12-15H2/t17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | NJAGDPGUZAYRBQ-TXVWBRJLSA-N |
| XLogP | 3.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|