C14H15BrO3 — CID 124638488
(1R)-4-bromo-5-methoxy-1-phenylmethoxycyclohexa-2,4-dien-1-ol (PubChem CID 124638488) has the molecular formula C14H15BrO3 and a molecular weight of 311.18 g/mol. Its IUPAC name is (1R)-4-bromo-5-methoxy-1-phenylmethoxycyclohexa-2,4-dien-1-ol.
| Compound Name | (1R)-4-bromo-5-methoxy-1-phenylmethoxycyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 124638488 |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (1R)-4-bromo-5-methoxy-1-phenylmethoxycyclohexa-2,4-dien-1-ol |
| SMILES | COC1=C(Br)C=C[C@](O)(OCc2ccccc2)C1 |
| InChI | InChI=1S/C14H15BrO3/c1-17-13-9-14(16,8-7-12(13)15)18-10-11-5-3-2-4-6-11/h2-8,16H,9-10H2,1H3/t14-/m0/s1 |
| InChIKey | CVVHDJZFGAJCJS-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|