C18H22O4 — CID 143381948
(1,6-dimethoxy-7-phenylmethoxy-2-bicyclo[5.1.0]octa-2,5-dienyl)methanol (PubChem CID 143381948) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1,6-dimethoxy-7-phenylmethoxy-2-bicyclo[5.1.0]octa-2,5-dienyl)methanol.
| Compound Name | (1,6-dimethoxy-7-phenylmethoxy-2-bicyclo[5.1.0]octa-2,5-dienyl)methanol |
|---|---|
| PubChem CID | 143381948 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1,6-dimethoxy-7-phenylmethoxy-2-bicyclo[5.1.0]octa-2,5-dienyl)methanol |
| SMILES | COC1=CCC=C(CO)C2(OC)CC12OCc1ccccc1 |
| InChI | InChI=1S/C18H22O4/c1-20-16-10-6-9-15(11-19)17(21-2)13-18(16,17)22-12-14-7-4-3-5-8-14/h3-5,7-10,19H,6,11-13H2,1-2H3 |
| InChIKey | DOHZCZRMYTZMDP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|