C14H20O3 — CID 101093358
4-[(2R,3R)-3-methyl-2-phenylmethoxyoxiran-2-yl]butan-1-ol (PubChem CID 101093358) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-[(2R,3R)-3-methyl-2-phenylmethoxyoxiran-2-yl]butan-1-ol.
| Compound Name | 4-[(2R,3R)-3-methyl-2-phenylmethoxyoxiran-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 101093358 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 4-[(2R,3R)-3-methyl-2-phenylmethoxyoxiran-2-yl]butan-1-ol |
| SMILES | C[C@H]1O[C@@]1(CCCCO)OCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-12-14(17-12,9-5-6-10-15)16-11-13-7-3-2-4-8-13/h2-4,7-8,12,15H,5-6,9-11H2,1H3/t12-,14-/m1/s1 |
| InChIKey | OMSLFPJHFJYEQL-TZMCWYRMSA-N |
| XLogP | 2.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|