C20H20O2 — CID 171034945
1-methoxy-3-(1-phenylmethoxycyclohexa-2,4-dien-1-yl)benzene (PubChem CID 171034945) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-methoxy-3-(1-phenylmethoxycyclohexa-2,4-dien-1-yl)benzene.
| Compound Name | 1-methoxy-3-(1-phenylmethoxycyclohexa-2,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 171034945 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-methoxy-3-(1-phenylmethoxycyclohexa-2,4-dien-1-yl)benzene |
| SMILES | COc1cccc(C2(OCc3ccccc3)C=CC=CC2)c1 |
| InChI | InChI=1S/C20H20O2/c1-21-19-12-8-11-18(15-19)20(13-6-3-7-14-20)22-16-17-9-4-2-5-10-17/h2-13,15H,14,16H2,1H3 |
| InChIKey | DXGIGHDGGQZISE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |