C24H32BrNO2 — CID 87855959
2-(3-methoxyphenyl)-2-methyl-1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octane bromide (PubChem CID 87855959) has the molecular formula C24H32BrNO2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-2-methyl-1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octane bromide.
| Compound Name | 2-(3-methoxyphenyl)-2-methyl-1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octane bromide |
|---|---|
| PubChem CID | 87855959 |
| Molecular Formula | C24H32BrNO2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(3-methoxyphenyl)-2-methyl-1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octane bromide |
| SMILES | COc1cccc(C2(C)CC3CC[N+]2(CCOCc2ccccc2)CC3)c1.[Br-] |
| InChI | InChI=1S/C24H32NO2.BrH/c1-24(22-9-6-10-23(17-22)26-2)18-20-11-13-25(24,14-12-20)15-16-27-19-21-7-4-3-5-8-21;/h3-10,17,20H,11-16,18-19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BJOQGCGZUXFWBX-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|