C26H31NO6 — CID 102161604
tert-butyl N-[(1R,5S,6R)-6-(3-methoxyphenyl)-2-oxo-6-(2-phenylmethoxyethyl)-3-oxabicyclo[3.1.0]hexan-1-yl]carbamate (PubChem CID 102161604) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is tert-butyl N-[(1R,5S,6R)-6-(3-methoxyphenyl)-2-oxo-6-(2-phenylmethoxyethyl)-3-oxabicyclo[3.1.0]hexan-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,5S,6R)-6-(3-methoxyphenyl)-2-oxo-6-(2-phenylmethoxyethyl)-3-oxabicyclo[3.1.0]hexan-1-yl]carbamate |
|---|---|
| PubChem CID | 102161604 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | tert-butyl N-[(1R,5S,6R)-6-(3-methoxyphenyl)-2-oxo-6-(2-phenylmethoxyethyl)-3-oxabicyclo[3.1.0]hexan-1-yl]carbamate |
| SMILES | COc1cccc([C@@]2(CCOCc3ccccc3)[C@@H]3COC(=O)[C@@]32NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H31NO6/c1-24(2,3)33-23(29)27-26-21(17-32-22(26)28)25(26,19-11-8-12-20(15-19)30-4)13-14-31-16-18-9-6-5-7-10-18/h5-12,15,21H,13-14,16-17H2,1-4H3,(H,27,29)/t21-,25-,26-/m0/s1 |
| InChIKey | ZRRIINNXIHYEGL-MZBJOSPHSA-N |
| XLogP | 3.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|