C28H33NO5 — CID 102223717
tert-butyl (1R,9S,10S)-6-methoxy-12-oxo-9-(2-phenylmethoxyethyl)-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate (PubChem CID 102223717) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is tert-butyl (1R,9S,10S)-6-methoxy-12-oxo-9-(2-phenylmethoxyethyl)-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate.
| Compound Name | tert-butyl (1R,9S,10S)-6-methoxy-12-oxo-9-(2-phenylmethoxyethyl)-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate |
|---|---|
| PubChem CID | 102223717 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | tert-butyl (1R,9S,10S)-6-methoxy-12-oxo-9-(2-phenylmethoxyethyl)-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate |
| SMILES | COc1ccc2c(c1)[C@]1(CCOCc3ccccc3)[C@@H]3CC(=O)CC[C@@]31N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33NO5/c1-26(2,3)34-25(31)29-23-11-10-21(32-4)17-22(23)27(24-16-20(30)12-13-28(24,27)29)14-15-33-18-19-8-6-5-7-9-19/h5-11,17,24H,12-16,18H2,1-4H3/t24-,27+,28+/m0/s1 |
| InChIKey | KWWCLCKZSBFBMI-HNPKZYAISA-N |
| XLogP | 5.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|