C22H26N2O — CID 23133712
1-(3-methoxyphenyl)-4-(2-phenylethylamino)cyclohexane-1-carbonitrile (PubChem CID 23133712) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-(2-phenylethylamino)cyclohexane-1-carbonitrile.
| Compound Name | 1-(3-methoxyphenyl)-4-(2-phenylethylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 23133712 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-(2-phenylethylamino)cyclohexane-1-carbonitrile |
| SMILES | COc1cccc(C2(C#N)CCC(NCCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O/c1-25-21-9-5-8-19(16-21)22(17-23)13-10-20(11-14-22)24-15-12-18-6-3-2-4-7-18/h2-9,16,20,24H,10-15H2,1H3 |
| InChIKey | HAAHYBMLNGSTNZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |