C21H25N3O3S — CID 23133731
3-[[[4-cyano-4-(3-methoxyphenyl)cyclohexyl]amino]methyl]benzenesulfonamide (PubChem CID 23133731) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-[[[4-cyano-4-(3-methoxyphenyl)cyclohexyl]amino]methyl]benzenesulfonamide.
| Compound Name | 3-[[[4-cyano-4-(3-methoxyphenyl)cyclohexyl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23133731 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[[[4-cyano-4-(3-methoxyphenyl)cyclohexyl]amino]methyl]benzenesulfonamide |
| SMILES | COc1cccc(C2(C#N)CCC(NCc3cccc(S(N)(=O)=O)c3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O3S/c1-27-19-6-3-5-17(13-19)21(15-22)10-8-18(9-11-21)24-14-16-4-2-7-20(12-16)28(23,25)26/h2-7,12-13,18,24H,8-11,14H2,1H3,(H2,23,25,26) |
| InChIKey | PJMLHEHFKGMWDN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |