C27H32N2O3S — CID 23161188
N-[1-(3-methoxyphenyl)-4-[(4-phenylphenyl)methylamino]cyclohexyl]methanesulfonamide (PubChem CID 23161188) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)-4-[(4-phenylphenyl)methylamino]cyclohexyl]methanesulfonamide.
| Compound Name | N-[1-(3-methoxyphenyl)-4-[(4-phenylphenyl)methylamino]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 23161188 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[1-(3-methoxyphenyl)-4-[(4-phenylphenyl)methylamino]cyclohexyl]methanesulfonamide |
| SMILES | COc1cccc(C2(NS(C)(=O)=O)CCC(NCc3ccc(-c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H32N2O3S/c1-32-26-10-6-9-24(19-26)27(29-33(2,30)31)17-15-25(16-18-27)28-20-21-11-13-23(14-12-21)22-7-4-3-5-8-22/h3-14,19,25,28-29H,15-18,20H2,1-2H3 |
| InChIKey | QFGLHTQGKJSFAS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |