C19H29Cl2N3O — CID 23133669
1-(3-methoxyphenyl)-4-(piperidin-4-ylamino)cyclohexane-1-carbonitrile;dihydrochloride (PubChem CID 23133669) has the molecular formula C19H29Cl2N3O and a molecular weight of 386.37 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-(piperidin-4-ylamino)cyclohexane-1-carbonitrile;dihydrochloride.
| Compound Name | 1-(3-methoxyphenyl)-4-(piperidin-4-ylamino)cyclohexane-1-carbonitrile;dihydrochloride |
|---|---|
| PubChem CID | 23133669 |
| Molecular Formula | C19H29Cl2N3O |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-(piperidin-4-ylamino)cyclohexane-1-carbonitrile;dihydrochloride |
| SMILES | COc1cccc(C2(C#N)CCC(NC3CCNCC3)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C19H27N3O.2ClH/c1-23-18-4-2-3-15(13-18)19(14-20)9-5-16(6-10-19)22-17-7-11-21-12-8-17;;/h2-4,13,16-17,21-22H,5-12H2,1H3;2*1H |
| InChIKey | SUMILTNYHXNUNZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |